C39H49BN2O6 — CID 178173293
[3-[2-[2-[(1S)-1-methoxyethyl]-5-phenylmethoxy-3-pyridinyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-2,2-dimethylpropyl] acetate (PubChem CID 178173293) has the molecular formula C39H49BN2O6 and a molecular weight of 652.64 g/mol. Its IUPAC name is [3-[2-[2-[(1S)-1-methoxyethyl]-5-phenylmethoxy-3-pyridinyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-2,2-dimethylpropyl] acetate.
| Compound Name | [3-[2-[2-[(1S)-1-methoxyethyl]-5-phenylmethoxy-3-pyridinyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-2,2-dimethylpropyl] acetate |
|---|---|
| PubChem CID | 178173293 |
| Molecular Formula | C39H49BN2O6 |
| Molecular Weight | 652.64 g/mol |
| Exact Mass | 652.37 |
| IUPAC Name | [3-[2-[2-[(1S)-1-methoxyethyl]-5-phenylmethoxy-3-pyridinyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl]-2,2-dimethylpropyl] acetate |
| SMILES | CO[C@@H](C)c1ncc(OCc2ccccc2)cc1-c1c(CC(C)(C)COC(C)=O)c2cc(B3OC(C)(C)C(C)(C)O3)cc3c2n1CCC3 |
| InChI | InChI=1S/C39H49BN2O6/c1-25(44-9)34-32(20-30(22-41-34)45-23-27-14-11-10-12-15-27)36-33(21-37(3,4)24-46-26(2)43)31-19-29(18-28-16-13-17-42(36)35(28)31)40-47-38(5,6)39(7,8)48-40/h10-12,14-15,18-20,22,25H,13,16-17,21,23-24H2,1-9H3/t25-/m0/s1 |
| InChIKey | DFQBPTFCJMGSIB-VWLOTQADSA-N |
| XLogP | 7.37 |
| TPSA | 81.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.64 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|