C22H26BNO4 — CID 67237120
benzyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate (PubChem CID 67237120) has the molecular formula C22H26BNO4 and a molecular weight of 379.27 g/mol. Its IUPAC name is benzyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate.
| Compound Name | benzyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 67237120 |
| Molecular Formula | C22H26BNO4 |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | benzyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroindole-1-carboxylate |
| SMILES | CC1(C)OB(c2ccc3c(c2)CCN3C(=O)OCc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C22H26BNO4/c1-21(2)22(3,4)28-23(27-21)18-10-11-19-17(14-18)12-13-24(19)20(25)26-15-16-8-6-5-7-9-16/h5-11,14H,12-13,15H2,1-4H3 |
| InChIKey | ZXNBGXGPMRTDFX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|