C16H22BNO4 — CID 66735439
6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid (PubChem CID 66735439) has the molecular formula C16H22BNO4 and a molecular weight of 303.17 g/mol. Its IUPAC name is 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid.
| Compound Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 66735439 |
| Molecular Formula | C16H22BNO4 |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinoline-2-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc3c(c2)CCN(C(=O)O)C3)OC1(C)C |
| InChI | InChI=1S/C16H22BNO4/c1-15(2)16(3,4)22-17(21-15)13-6-5-12-10-18(14(19)20)8-7-11(12)9-13/h5-6,9H,7-8,10H2,1-4H3,(H,19,20) |
| InChIKey | UCCIGAQQDJIEQN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|