C27H39BN4O3 — CID 142399065
2-[1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]pyrimidin-4-yl]piperidin-4-yl]propan-2-ol (PubChem CID 142399065) has the molecular formula C27H39BN4O3 and a molecular weight of 478.45 g/mol. Its IUPAC name is 2-[1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]pyrimidin-4-yl]piperidin-4-yl]propan-2-ol.
| Compound Name | 2-[1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]pyrimidin-4-yl]piperidin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 142399065 |
| Molecular Formula | C27H39BN4O3 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | 2-[1-[2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-1H-isoquinolin-2-yl]pyrimidin-4-yl]piperidin-4-yl]propan-2-ol |
| SMILES | CC(C)(O)C1CCN(c2ccnc(N3CCc4cc(B5OC(C)(C)C(C)(C)O5)ccc4C3)n2)CC1 |
| InChI | InChI=1S/C27H39BN4O3/c1-25(2,33)21-11-15-31(16-12-21)23-9-13-29-24(30-23)32-14-10-19-17-22(8-7-20(19)18-32)28-34-26(3,4)27(5,6)35-28/h7-9,13,17,21,33H,10-12,14-16,18H2,1-6H3 |
| InChIKey | LXMDFLMESDTBPF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|