C17H22BN3O2S — CID 171059240
5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 171059240) has the molecular formula C17H22BN3O2S and a molecular weight of 343.26 g/mol. Its IUPAC name is 5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 171059240 |
| Molecular Formula | C17H22BN3O2S |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | CC1(C)OB(c2cnc(N3CCc4sccc4C3)nc2)OC1(C)C |
| InChI | InChI=1S/C17H22BN3O2S/c1-16(2)17(3,4)23-18(22-16)13-9-19-15(20-10-13)21-7-5-14-12(11-21)6-8-24-14/h6,8-10H,5,7,11H2,1-4H3 |
| InChIKey | MZDSTPFULXYIJL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|