C15H23BFN3O3 — CID 129406806
(3R,4R)-3-fluoro-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-4-ol (PubChem CID 129406806) has the molecular formula C15H23BFN3O3 and a molecular weight of 323.18 g/mol. Its IUPAC name is (3R,4R)-3-fluoro-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-4-ol.
| Compound Name | (3R,4R)-3-fluoro-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 129406806 |
| Molecular Formula | C15H23BFN3O3 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | (3R,4R)-3-fluoro-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-4-ol |
| SMILES | CC1(C)OB(c2cnc(N3CC[C@@H](O)[C@H](F)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C15H23BFN3O3/c1-14(2)15(3,4)23-16(22-14)10-7-18-13(19-8-10)20-6-5-12(21)11(17)9-20/h7-8,11-12,21H,5-6,9H2,1-4H3/t11-,12-/m1/s1 |
| InChIKey | HQXNHZCGYDRQCA-VXGBXAGGSA-N |
| XLogP | 0.68 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|