C14H23BN4O3S — CID 140760002
1-imino-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-1,4-thiazinane 1-oxide (PubChem CID 140760002) has the molecular formula C14H23BN4O3S and a molecular weight of 338.24 g/mol. Its IUPAC name is 1-imino-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-1,4-thiazinane 1-oxide.
| Compound Name | 1-imino-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 140760002 |
| Molecular Formula | C14H23BN4O3S |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-imino-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]-1,4-thiazinane 1-oxide |
| SMILES | [H]N=S1(=O)CCN(c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)CC1 |
| InChI | InChI=1S/C14H23BN4O3S/c1-13(2)14(3,4)22-15(21-13)11-9-17-12(18-10-11)19-5-7-23(16,20)8-6-19/h9-10,16H,5-8H2,1-4H3 |
| InChIKey | IUDZBVAFGMTZCE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|