C18H32BN5O2 — CID 71647895
N'-methyl-N'-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]ethane-1,2-diamine (PubChem CID 71647895) has the molecular formula C18H32BN5O2 and a molecular weight of 361.30 g/mol. Its IUPAC name is N'-methyl-N'-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 71647895 |
| Molecular Formula | C18H32BN5O2 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | N'-methyl-N'-[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]ethane-1,2-diamine |
| SMILES | CN(CCN)C1CCCN(c2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C18H32BN5O2/c1-17(2)18(3,4)26-19(25-17)14-11-21-16(22-12-14)24-9-6-7-15(13-24)23(5)10-8-20/h11-12,15H,6-10,13,20H2,1-5H3 |
| InChIKey | GZWLDNFYSDRUHB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|