C18H24BN3O2 — CID 169265947
2-pyrrolidin-1-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline (PubChem CID 169265947) has the molecular formula C18H24BN3O2 and a molecular weight of 325.22 g/mol. Its IUPAC name is 2-pyrrolidin-1-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline.
| Compound Name | 2-pyrrolidin-1-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline |
|---|---|
| PubChem CID | 169265947 |
| Molecular Formula | C18H24BN3O2 |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 2-pyrrolidin-1-yl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinazoline |
| SMILES | CC1(C)OB(c2ccc3nc(N4CCCC4)ncc3c2)OC1(C)C |
| InChI | InChI=1S/C18H24BN3O2/c1-17(2)18(3,4)24-19(23-17)14-7-8-15-13(11-14)12-20-16(21-15)22-9-5-6-10-22/h7-8,11-12H,5-6,9-10H2,1-4H3 |
| InChIKey | WGUFADOGUFEFBH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|