C19H24BNO2 — CID 176514531
7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroacridine (PubChem CID 176514531) has the molecular formula C19H24BNO2 and a molecular weight of 309.22 g/mol. Its IUPAC name is 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroacridine.
| Compound Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 176514531 |
| Molecular Formula | C19H24BNO2 |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,2,3,4-tetrahydroacridine |
| SMILES | CC1(C)OB(c2ccc3nc4c(cc3c2)CCCC4)OC1(C)C |
| InChI | InChI=1S/C19H24BNO2/c1-18(2)19(3,4)23-20(22-18)15-9-10-17-14(12-15)11-13-7-5-6-8-16(13)21-17/h9-12H,5-8H2,1-4H3 |
| InChIKey | WYFPHXOJFLYZEZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|