C15H18BNO3 — CID 123398294
2-ethenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole (PubChem CID 123398294) has the molecular formula C15H18BNO3 and a molecular weight of 271.13 g/mol. Its IUPAC name is 2-ethenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole.
| Compound Name | 2-ethenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 123398294 |
| Molecular Formula | C15H18BNO3 |
| Molecular Weight | 271.13 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-ethenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
| SMILES | C=Cc1nc2ccc(B3OC(C)(C)C(C)(C)O3)cc2o1 |
| InChI | InChI=1S/C15H18BNO3/c1-6-13-17-11-8-7-10(9-12(11)18-13)16-19-14(2,3)15(4,5)20-16/h6-9H,1H2,2-5H3 |
| InChIKey | ZPICYNBAVGTLBU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.13 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|