C19H26BNO2 — CID 176514533
2-methyl-3-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (PubChem CID 176514533) has the molecular formula C19H26BNO2 and a molecular weight of 311.23 g/mol. Its IUPAC name is 2-methyl-3-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline.
| Compound Name | 2-methyl-3-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
|---|---|
| PubChem CID | 176514533 |
| Molecular Formula | C19H26BNO2 |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 2-methyl-3-propyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| SMILES | CCCc1cc2cc(B3OC(C)(C)C(C)(C)O3)ccc2nc1C |
| InChI | InChI=1S/C19H26BNO2/c1-7-8-14-11-15-12-16(9-10-17(15)21-13(14)2)20-22-18(3,4)19(5,6)23-20/h9-12H,7-8H2,1-6H3 |
| InChIKey | GPFABTYHQVQKPU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|