C15H19BO3 — CID 131166925
4,4,5,5-tetramethyl-2-(2-methyl-1-benzofuran-5-yl)-1,3,2-dioxaborolane (PubChem CID 131166925) has the molecular formula C15H19BO3 and a molecular weight of 258.13 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(2-methyl-1-benzofuran-5-yl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(2-methyl-1-benzofuran-5-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 131166925 |
| Molecular Formula | C15H19BO3 |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(2-methyl-1-benzofuran-5-yl)-1,3,2-dioxaborolane |
| SMILES | Cc1cc2cc(B3OC(C)(C)C(C)(C)O3)ccc2o1 |
| InChI | InChI=1S/C15H19BO3/c1-10-8-11-9-12(6-7-13(11)17-10)16-18-14(2,3)15(4,5)19-16/h6-9H,1-5H3 |
| InChIKey | YDQPLTKMVOPUOX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|