C17H20BN3O3 — CID 140812753
2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole (PubChem CID 140812753) has the molecular formula C17H20BN3O3 and a molecular weight of 325.18 g/mol. Its IUPAC name is 2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole.
| Compound Name | 2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 140812753 |
| Molecular Formula | C17H20BN3O3 |
| Molecular Weight | 325.18 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazole |
| SMILES | Cn1cc(-c2nc3cc(B4OC(C)(C)C(C)(C)O4)ccc3o2)cn1 |
| InChI | InChI=1S/C17H20BN3O3/c1-16(2)17(3,4)24-18(23-16)12-6-7-14-13(8-12)20-15(22-14)11-9-19-21(5)10-11/h6-10H,1-5H3 |
| InChIKey | WWHJTWNEVSATKY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|