C20H28BN3O4 — CID 174029095
(5S)-1-methyl-5-[[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]methylamino]methyl]pyrrolidin-2-one (PubChem CID 174029095) has the molecular formula C20H28BN3O4 and a molecular weight of 385.27 g/mol. Its IUPAC name is (5S)-1-methyl-5-[[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]methylamino]methyl]pyrrolidin-2-one.
| Compound Name | (5S)-1-methyl-5-[[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]methylamino]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 174029095 |
| Molecular Formula | C20H28BN3O4 |
| Molecular Weight | 385.27 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | (5S)-1-methyl-5-[[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]methylamino]methyl]pyrrolidin-2-one |
| SMILES | CN1C(=O)CC[C@H]1CNCc1nc2cc(B3OC(C)(C)C(C)(C)O3)ccc2o1 |
| InChI | InChI=1S/C20H28BN3O4/c1-19(2)20(3,4)28-21(27-19)13-6-8-16-15(10-13)23-17(26-16)12-22-11-14-7-9-18(25)24(14)5/h6,8,10,14,22H,7,9,11-12H2,1-5H3/t14-/m0/s1 |
| InChIKey | DNXOFJRGMFMNSP-AWEZNQCLSA-N |
| XLogP | 1.84 |
| TPSA | 76.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|