C32H38BClN4O4S2 — CID 165069963
4-(5-chloro-1,3-benzothiazol-2-yl)-1-methylpiperidin-2-one;1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]piperidin-2-one (PubChem CID 165069963) has the molecular formula C32H38BClN4O4S2 and a molecular weight of 653.08 g/mol. Its IUPAC name is 4-(5-chloro-1,3-benzothiazol-2-yl)-1-methylpiperidin-2-one;1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]piperidin-2-one.
| Compound Name | 4-(5-chloro-1,3-benzothiazol-2-yl)-1-methylpiperidin-2-one;1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]piperidin-2-one |
|---|---|
| PubChem CID | 165069963 |
| Molecular Formula | C32H38BClN4O4S2 |
| Molecular Weight | 653.08 g/mol |
| Exact Mass | 652.21 |
| IUPAC Name | 4-(5-chloro-1,3-benzothiazol-2-yl)-1-methylpiperidin-2-one;1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]piperidin-2-one |
| SMILES | CN1CCC(c2nc3cc(B4OC(C)(C)C(C)(C)O4)ccc3s2)CC1=O.CN1CCC(c2nc3cc(Cl)ccc3s2)CC1=O |
| InChI | InChI=1S/C19H25BN2O3S.C13H13ClN2OS/c1-18(2)19(3,4)25-20(24-18)13-6-7-15-14(11-13)21-17(26-15)12-8-9-22(5)16(23)10-12;1-16-5-4-8(6-12(16)17)13-15-10-7-9(14)2-3-11(10)18-13/h6-7,11-12H,8-10H2,1-5H3;2-3,7-8H,4-6H2,1H3 |
| InChIKey | SPBFCFDAORQBND-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.08 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|