C19H27BN2O3S — CID 164752163
4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]ethyl]morpholine (PubChem CID 164752163) has the molecular formula C19H27BN2O3S and a molecular weight of 374.32 g/mol. Its IUPAC name is 4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]ethyl]morpholine.
| Compound Name | 4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]ethyl]morpholine |
|---|---|
| PubChem CID | 164752163 |
| Molecular Formula | C19H27BN2O3S |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]ethyl]morpholine |
| SMILES | CC1(C)OB(c2ccc3sc(CCN4CCOCC4)nc3c2)OC1(C)C |
| InChI | InChI=1S/C19H27BN2O3S/c1-18(2)19(3,4)25-20(24-18)14-5-6-16-15(13-14)21-17(26-16)7-8-22-9-11-23-12-10-22/h5-6,13H,7-12H2,1-4H3 |
| InChIKey | ZXSRFYNPIGHNQF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|