C19H27BN2O3S — CID 164751725
N,N-dimethyl-1-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]oxetan-3-yl]methanamine (PubChem CID 164751725) has the molecular formula C19H27BN2O3S and a molecular weight of 374.32 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]oxetan-3-yl]methanamine.
| Compound Name | N,N-dimethyl-1-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]oxetan-3-yl]methanamine |
|---|---|
| PubChem CID | 164751725 |
| Molecular Formula | C19H27BN2O3S |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N,N-dimethyl-1-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]oxetan-3-yl]methanamine |
| SMILES | CN(C)CC1(c2nc3cc(B4OC(C)(C)C(C)(C)O4)ccc3s2)COC1 |
| InChI | InChI=1S/C19H27BN2O3S/c1-17(2)18(3,4)25-20(24-17)13-7-8-15-14(9-13)21-16(26-15)19(10-22(5)6)11-23-12-19/h7-9H,10-12H2,1-6H3 |
| InChIKey | VYDKMPXRZBZSLE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|