C32H42BClN4O4S2 — CID 174054639
4-(5-chloro-1,3-benzothiazol-2-yl)-1-methylpiperidin-4-ol;1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]piperidin-4-ol (PubChem CID 174054639) has the molecular formula C32H42BClN4O4S2 and a molecular weight of 657.11 g/mol. Its IUPAC name is 4-(5-chloro-1,3-benzothiazol-2-yl)-1-methylpiperidin-4-ol;1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]piperidin-4-ol.
| Compound Name | 4-(5-chloro-1,3-benzothiazol-2-yl)-1-methylpiperidin-4-ol;1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 174054639 |
| Molecular Formula | C32H42BClN4O4S2 |
| Molecular Weight | 657.11 g/mol |
| Exact Mass | 656.24 |
| IUPAC Name | 4-(5-chloro-1,3-benzothiazol-2-yl)-1-methylpiperidin-4-ol;1-methyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]piperidin-4-ol |
| SMILES | CN1CCC(O)(c2nc3cc(B4OC(C)(C)C(C)(C)O4)ccc3s2)CC1.CN1CCC(O)(c2nc3cc(Cl)ccc3s2)CC1 |
| InChI | InChI=1S/C19H27BN2O3S.C13H15ClN2OS/c1-17(2)18(3,4)25-20(24-17)13-6-7-15-14(12-13)21-16(26-15)19(23)8-10-22(5)11-9-19;1-16-6-4-13(17,5-7-16)12-15-10-8-9(14)2-3-11(10)18-12/h6-7,12,23H,8-11H2,1-5H3;2-3,8,17H,4-7H2,1H3 |
| InChIKey | HILZCAZXGDUKIM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.11 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|