C30H38BClN4O4S2 — CID 174054589
2-(5-chloro-1,3-benzothiazol-2-yl)-4-methylmorpholine;4-methyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]morpholine (PubChem CID 174054589) has the molecular formula C30H38BClN4O4S2 and a molecular weight of 629.06 g/mol. Its IUPAC name is 2-(5-chloro-1,3-benzothiazol-2-yl)-4-methylmorpholine;4-methyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]morpholine.
| Compound Name | 2-(5-chloro-1,3-benzothiazol-2-yl)-4-methylmorpholine;4-methyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]morpholine |
|---|---|
| PubChem CID | 174054589 |
| Molecular Formula | C30H38BClN4O4S2 |
| Molecular Weight | 629.06 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | 2-(5-chloro-1,3-benzothiazol-2-yl)-4-methylmorpholine;4-methyl-2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]morpholine |
| SMILES | CN1CCOC(c2nc3cc(B4OC(C)(C)C(C)(C)O4)ccc3s2)C1.CN1CCOC(c2nc3cc(Cl)ccc3s2)C1 |
| InChI | InChI=1S/C18H25BN2O3S.C12H13ClN2OS/c1-17(2)18(3,4)24-19(23-17)12-6-7-15-13(10-12)20-16(25-15)14-11-21(5)8-9-22-14;1-15-4-5-16-10(7-15)12-14-9-6-8(13)2-3-11(9)17-12/h6-7,10,14H,8-9,11H2,1-5H3;2-3,6,10H,4-5,7H2,1H3 |
| InChIKey | FDMBHKGQXVPUCN-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.06 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|