C30H24BClN4O2S2 — CID 174003114
5-chloro-2-[2-[[4,5,5-trimethyl-2-(2-pyridin-4-yl-1,3-benzothiazol-5-yl)-1,3,2-dioxaborolan-4-yl]methyl]-4-pyridinyl]-1,3-benzothiazole (PubChem CID 174003114) has the molecular formula C30H24BClN4O2S2 and a molecular weight of 582.95 g/mol. Its IUPAC name is 5-chloro-2-[2-[[4,5,5-trimethyl-2-(2-pyridin-4-yl-1,3-benzothiazol-5-yl)-1,3,2-dioxaborolan-4-yl]methyl]-4-pyridinyl]-1,3-benzothiazole.
| Compound Name | 5-chloro-2-[2-[[4,5,5-trimethyl-2-(2-pyridin-4-yl-1,3-benzothiazol-5-yl)-1,3,2-dioxaborolan-4-yl]methyl]-4-pyridinyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 174003114 |
| Molecular Formula | C30H24BClN4O2S2 |
| Molecular Weight | 582.95 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | 5-chloro-2-[2-[[4,5,5-trimethyl-2-(2-pyridin-4-yl-1,3-benzothiazol-5-yl)-1,3,2-dioxaborolan-4-yl]methyl]-4-pyridinyl]-1,3-benzothiazole |
| SMILES | CC1(C)OB(c2ccc3sc(-c4ccncc4)nc3c2)OC1(C)Cc1cc(-c2nc3cc(Cl)ccc3s2)ccn1 |
| InChI | InChI=1S/C30H24BClN4O2S2/c1-29(2)30(3,17-22-14-19(10-13-34-22)28-36-24-16-21(32)5-7-26(24)40-28)38-31(37-29)20-4-6-25-23(15-20)35-27(39-25)18-8-11-33-12-9-18/h4-16H,17H2,1-3H3 |
| InChIKey | HHKPJJSYVLMQGS-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.95 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|