C21H31BN2O2S — CID 169112782
2-[(1,4-dimethylpiperidin-4-yl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole (PubChem CID 169112782) has the molecular formula C21H31BN2O2S and a molecular weight of 386.37 g/mol. Its IUPAC name is 2-[(1,4-dimethylpiperidin-4-yl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole.
| Compound Name | 2-[(1,4-dimethylpiperidin-4-yl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 169112782 |
| Molecular Formula | C21H31BN2O2S |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-[(1,4-dimethylpiperidin-4-yl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazole |
| SMILES | CN1CCC(C)(Cc2nc3cc(B4OC(C)(C)C(C)(C)O4)ccc3s2)CC1 |
| InChI | InChI=1S/C21H31BN2O2S/c1-19(2)20(3,4)26-22(25-19)15-7-8-17-16(13-15)23-18(27-17)14-21(5)9-11-24(6)12-10-21/h7-8,13H,9-12,14H2,1-6H3 |
| InChIKey | WQGSNJJIHAVWJV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|