C31H38BNO5S — CID 165034239
tert-butyl 2-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]propanoyl]-1,3-dihydroinden-2-yl]acetate (PubChem CID 165034239) has the molecular formula C31H38BNO5S and a molecular weight of 547.53 g/mol. Its IUPAC name is tert-butyl 2-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]propanoyl]-1,3-dihydroinden-2-yl]acetate.
| Compound Name | tert-butyl 2-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]propanoyl]-1,3-dihydroinden-2-yl]acetate |
|---|---|
| PubChem CID | 165034239 |
| Molecular Formula | C31H38BNO5S |
| Molecular Weight | 547.53 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | tert-butyl 2-[2-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]propanoyl]-1,3-dihydroinden-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CC1(C(=O)CCc2nc3cc(B4OC(C)(C)C(C)(C)O4)ccc3s2)Cc2ccccc2C1 |
| InChI | InChI=1S/C31H38BNO5S/c1-28(2,3)36-27(35)19-31(17-20-10-8-9-11-21(20)18-31)25(34)14-15-26-33-23-16-22(12-13-24(23)39-26)32-37-29(4,5)30(6,7)38-32/h8-13,16H,14-15,17-19H2,1-7H3 |
| InChIKey | NDDPMPOIKGPYAT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.53 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|