C17H23BN2O2S — CID 175802604
[1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]cyclopropyl]methanamine (PubChem CID 175802604) has the molecular formula C17H23BN2O2S and a molecular weight of 330.26 g/mol. Its IUPAC name is [1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]cyclopropyl]methanamine.
| Compound Name | [1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]cyclopropyl]methanamine |
|---|---|
| PubChem CID | 175802604 |
| Molecular Formula | C17H23BN2O2S |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | [1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzothiazol-2-yl]cyclopropyl]methanamine |
| SMILES | CC1(C)OB(c2ccc3sc(C4(CN)CC4)nc3c2)OC1(C)C |
| InChI | InChI=1S/C17H23BN2O2S/c1-15(2)16(3,4)22-18(21-15)11-5-6-13-12(9-11)20-14(23-13)17(10-19)7-8-17/h5-6,9H,7-8,10,19H2,1-4H3 |
| InChIKey | GYUDHOHQSOSRTM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|