About [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine
[1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine (PubChem CID 115450810) has the molecular formula C11H11BrN2S
and a molecular weight of 283.19 g/mol. Its IUPAC name is [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine.
Molecular Properties
| Compound Name | [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine |
| PubChem CID | 115450810 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine |
| SMILES | NCC1(c2nc3ccc(Br)cc3s2)CC1 |
| InChI | InChI=1S/C11H11BrN2S/c12-7-1-2-8-9(5-7)15-10(14-8)11(6-13)3-4-11/h1-2,5H,3-4,6,13H2 |
| InChIKey | CTBGAMPIYSLFES-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine?
The IUPAC name of [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine (CID 115450810) is [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine.
What is the SMILES notation for [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine?
The canonical SMILES for [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine is NCC1(c2nc3ccc(Br)cc3s2)CC1.
What is the InChIKey of [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine?
The InChIKey is CTBGAMPIYSLFES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2S/c12-7-1-2-8-9(5-7)15-10(14-8)11(6-13)3-4-11/h1-2,5H,3-4,6,13H2.
What are the key properties of [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine?
[1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine has a molecular weight of 283.19 g/mol, XLogP of 3.05, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(6-bromo-1,3-benzothiazol-2-yl)cyclopropyl]methanamine is sourced from PubChem (CID 115450810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).