C13H15BrN2S — CID 79534201
1-(6-bromo-1,3-benzothiazol-2-yl)cyclohexan-1-amine (PubChem CID 79534201) has the molecular formula C13H15BrN2S and a molecular weight of 311.25 g/mol. Its IUPAC name is 1-(6-bromo-1,3-benzothiazol-2-yl)cyclohexan-1-amine.
| Compound Name | 1-(6-bromo-1,3-benzothiazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 79534201 |
| Molecular Formula | C13H15BrN2S |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 1-(6-bromo-1,3-benzothiazol-2-yl)cyclohexan-1-amine |
| SMILES | NC1(c2nc3ccc(Br)cc3s2)CCCCC1 |
| InChI | InChI=1S/C13H15BrN2S/c14-9-4-5-10-11(8-9)17-12(16-10)13(15)6-2-1-3-7-13/h4-5,8H,1-3,6-7,15H2 |
| InChIKey | JDVBHWQSIPHAHH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |