C12H13ClN2S — CID 115445980
[1-(5-chloro-1,3-benzothiazol-2-yl)cyclobutyl]methanamine (PubChem CID 115445980) has the molecular formula C12H13ClN2S and a molecular weight of 252.77 g/mol. Its IUPAC name is [1-(5-chloro-1,3-benzothiazol-2-yl)cyclobutyl]methanamine.
| Compound Name | [1-(5-chloro-1,3-benzothiazol-2-yl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 115445980 |
| Molecular Formula | C12H13ClN2S |
| Molecular Weight | 252.77 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | [1-(5-chloro-1,3-benzothiazol-2-yl)cyclobutyl]methanamine |
| SMILES | NCC1(c2nc3cc(Cl)ccc3s2)CCC1 |
| InChI | InChI=1S/C12H13ClN2S/c13-8-2-3-10-9(6-8)15-11(16-10)12(7-14)4-1-5-12/h2-3,6H,1,4-5,7,14H2 |
| InChIKey | HXJXZQBMSFBNBU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.77 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |