C18H21ClN2S — CID 56513636
5-chloro-2-(1-cyclohex-2-en-1-ylpiperidin-4-yl)-1,3-benzothiazole (PubChem CID 56513636) has the molecular formula C18H21ClN2S and a molecular weight of 332.90 g/mol. Its IUPAC name is 5-chloro-2-(1-cyclohex-2-en-1-ylpiperidin-4-yl)-1,3-benzothiazole.
| Compound Name | 5-chloro-2-(1-cyclohex-2-en-1-ylpiperidin-4-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 56513636 |
| Molecular Formula | C18H21ClN2S |
| Molecular Weight | 332.90 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 5-chloro-2-(1-cyclohex-2-en-1-ylpiperidin-4-yl)-1,3-benzothiazole |
| SMILES | Clc1ccc2sc(C3CCN(C4C=CCCC4)CC3)nc2c1 |
| InChI | InChI=1S/C18H21ClN2S/c19-14-6-7-17-16(12-14)20-18(22-17)13-8-10-21(11-9-13)15-4-2-1-3-5-15/h2,4,6-7,12-13,15H,1,3,5,8-11H2 |
| InChIKey | NAYWHDIRYUJTJU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|