C16H17ClN4S3 — CID 34890128
3-[[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-methyl-1,3,4-thiadiazole-2-thione (PubChem CID 34890128) has the molecular formula C16H17ClN4S3 and a molecular weight of 396.99 g/mol. Its IUPAC name is 3-[[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-methyl-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-methyl-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 34890128 |
| Molecular Formula | C16H17ClN4S3 |
| Molecular Weight | 396.99 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 3-[[4-(5-chloro-1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-methyl-1,3,4-thiadiazole-2-thione |
| SMILES | Cc1nn(CN2CCC(c3nc4cc(Cl)ccc4s3)CC2)c(=S)s1 |
| InChI | InChI=1S/C16H17ClN4S3/c1-10-19-21(16(22)23-10)9-20-6-4-11(5-7-20)15-18-13-8-12(17)2-3-14(13)24-15/h2-3,8,11H,4-7,9H2,1H3 |
| InChIKey | XRSFDAMWZVCSRL-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.99 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|