C19H23N5S2 — CID 9241580
2-[[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 9241580) has the molecular formula C19H23N5S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is 2-[[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9241580 |
| Molecular Formula | C19H23N5S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[[4-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(C)nn(CN2CCC(c3nc4ccccc4s3)CC2)c1=S |
| InChI | InChI=1S/C19H23N5S2/c1-3-10-23-14(2)21-24(19(23)25)13-22-11-8-15(9-12-22)18-20-16-6-4-5-7-17(16)26-18/h3-7,15H,1,8-13H2,2H3 |
| InChIKey | BYGCRLCUHIOIOH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|