C18H21N5S2 — CID 9279651
2-[[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 9279651) has the molecular formula C18H21N5S2 and a molecular weight of 371.54 g/mol. Its IUPAC name is 2-[[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9279651 |
| Molecular Formula | C18H21N5S2 |
| Molecular Weight | 371.54 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-[[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1cnn(CN2CCC[C@H](c3nc4ccccc4s3)C2)c1=S |
| InChI | InChI=1S/C18H21N5S2/c1-2-9-22-12-19-23(18(22)24)13-21-10-5-6-14(11-21)17-20-15-7-3-4-8-16(15)25-17/h2-4,7-8,12,14H,1,5-6,9-11,13H2/t14-/m0/s1 |
| InChIKey | PLEFROAGJIHUOV-AWEZNQCLSA-N |
| XLogP | 4.05 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|