C21H27N3O2S — CID 9279657
1-[[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-ethyl-4-methylpiperidine-2,6-dione (PubChem CID 9279657) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-[[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-ethyl-4-methylpiperidine-2,6-dione.
| Compound Name | 1-[[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-ethyl-4-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 9279657 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[[(3S)-3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-4-ethyl-4-methylpiperidine-2,6-dione |
| SMILES | CCC1(C)CC(=O)N(CN2CCC[C@H](c3nc4ccccc4s3)C2)C(=O)C1 |
| InChI | InChI=1S/C21H27N3O2S/c1-3-21(2)11-18(25)24(19(26)12-21)14-23-10-6-7-15(13-23)20-22-16-8-4-5-9-17(16)27-20/h4-5,8-9,15H,3,6-7,10-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | JYDIOECHQVYCHM-HNNXBMFYSA-N |
| XLogP | 4.00 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|