C29H27N3O3S — CID 167567721
1-[2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-3-methyl-3-naphthalen-2-ylpyrrolidine-2,5-dione (PubChem CID 167567721) has the molecular formula C29H27N3O3S and a molecular weight of 497.62 g/mol. Its IUPAC name is 1-[2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-3-methyl-3-naphthalen-2-ylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-3-methyl-3-naphthalen-2-ylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 167567721 |
| Molecular Formula | C29H27N3O3S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 1-[2-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-3-methyl-3-naphthalen-2-ylpyrrolidine-2,5-dione |
| SMILES | CC1(c2ccc3ccccc3c2)CC(=O)N(CC(=O)N2CCCC(c3nc4ccccc4s3)C2)C1=O |
| InChI | InChI=1S/C29H27N3O3S/c1-29(22-13-12-19-7-2-3-8-20(19)15-22)16-25(33)32(28(29)35)18-26(34)31-14-6-9-21(17-31)27-30-23-10-4-5-11-24(23)36-27/h2-5,7-8,10-13,15,21H,6,9,14,16-18H2,1H3 |
| InChIKey | FMPFOACFYSLMPS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|