C28H26N4O3S — CID 41193621
(5R)-3-[2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 41193621) has the molecular formula C28H26N4O3S and a molecular weight of 498.61 g/mol. Its IUPAC name is (5R)-3-[2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-[2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41193621 |
| Molecular Formula | C28H26N4O3S |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | (5R)-3-[2-[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccc3ccccc3c2)NC(=O)N(CC(=O)N2CCCC[C@H]2c2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C28H26N4O3S/c1-28(20-14-13-18-8-2-3-9-19(18)16-20)26(34)32(27(35)30-28)17-24(33)31-15-7-6-11-22(31)25-29-21-10-4-5-12-23(21)36-25/h2-5,8-10,12-14,16,22H,6-7,11,15,17H2,1H3,(H,30,35)/t22-,28+/m0/s1 |
| InChIKey | JWRZEGRKUDRQDK-RBISFHTESA-N |
| XLogP | 4.97 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|