C28H29N3O5 — CID 41176561
(5S)-3-[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione (PubChem CID 41176561) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is (5S)-3-[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 41176561 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | (5S)-3-[2-[(2S)-2-(2,4-dimethoxyphenyl)pyrrolidin-1-yl]-2-oxoethyl]-5-methyl-5-naphthalen-2-ylimidazolidine-2,4-dione |
| SMILES | COc1ccc([C@@H]2CCCN2C(=O)CN2C(=O)N[C@@](C)(c3ccc4ccccc4c3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C28H29N3O5/c1-28(20-11-10-18-7-4-5-8-19(18)15-20)26(33)31(27(34)29-28)17-25(32)30-14-6-9-23(30)22-13-12-21(35-2)16-24(22)36-3/h4-5,7-8,10-13,15-16,23H,6,9,14,17H2,1-3H3,(H,29,34)/t23-,28-/m0/s1 |
| InChIKey | MBHRIRSXSYQJNQ-FIPFOOKPSA-N |
| XLogP | 3.99 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|