C22H20F2N4O2S — CID 17479641
3-[[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 17479641) has the molecular formula C22H20F2N4O2S and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-[[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17479641 |
| Molecular Formula | C22H20F2N4O2S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 3-[[2-(1,3-benzothiazol-2-yl)pyrrolidin-1-yl]methyl]-5-(3,4-difluorophenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(F)c(F)c2)NC(=O)N(CN2CCCC2c2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C22H20F2N4O2S/c1-22(13-8-9-14(23)15(24)11-13)20(29)28(21(30)26-22)12-27-10-4-6-17(27)19-25-16-5-2-3-7-18(16)31-19/h2-3,5,7-9,11,17H,4,6,10,12H2,1H3,(H,26,30) |
| InChIKey | ZEDJCQHNOLGCDG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|