C19H22N4O3S — CID 18093302
1-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-propylimidazolidine-2,4,5-trione (PubChem CID 18093302) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 1-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-propylimidazolidine-2,4,5-trione.
| Compound Name | 1-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-propylimidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 18093302 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 1-[[2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-propylimidazolidine-2,4,5-trione |
| SMILES | CCCN1C(=O)C(=O)N(CN2CCCCC2c2nc3ccccc3s2)C1=O |
| InChI | InChI=1S/C19H22N4O3S/c1-2-10-22-17(24)18(25)23(19(22)26)12-21-11-6-5-8-14(21)16-20-13-7-3-4-9-15(13)27-16/h3-4,7,9,14H,2,5-6,8,10-12H2,1H3 |
| InChIKey | BESUDQRPBWSBQJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|