C17H20N4S2 — CID 9330282
1-[[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-methylimidazole-2-thione (PubChem CID 9330282) has the molecular formula C17H20N4S2 and a molecular weight of 344.51 g/mol. Its IUPAC name is 1-[[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-methylimidazole-2-thione.
| Compound Name | 1-[[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-methylimidazole-2-thione |
|---|---|
| PubChem CID | 9330282 |
| Molecular Formula | C17H20N4S2 |
| Molecular Weight | 344.51 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-3-methylimidazole-2-thione |
| SMILES | Cn1ccn(CN2CCCC[C@H]2c2nc3ccccc3s2)c1=S |
| InChI | InChI=1S/C17H20N4S2/c1-19-10-11-21(17(19)22)12-20-9-5-4-7-14(20)16-18-13-6-2-3-8-15(13)23-16/h2-3,6,8,10-11,14H,4-5,7,9,12H2,1H3/t14-/m0/s1 |
| InChIKey | JNFCCGZGYGFTMZ-AWEZNQCLSA-N |
| XLogP | 4.35 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|