C28H26N4O2S — CID 31388680
3-[[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 31388680) has the molecular formula C28H26N4O2S and a molecular weight of 482.61 g/mol. Its IUPAC name is 3-[[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 31388680 |
| Molecular Formula | C28H26N4O2S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 3-[[(2S)-2-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1CN1CCCC[C@H]1c1nc2ccccc2s1 |
| InChI | InChI=1S/C28H26N4O2S/c33-26-28(20-11-3-1-4-12-20,21-13-5-2-6-14-21)30-27(34)32(26)19-31-18-10-9-16-23(31)25-29-22-15-7-8-17-24(22)35-25/h1-8,11-15,17,23H,9-10,16,18-19H2,(H,30,34)/t23-/m0/s1 |
| InChIKey | JZDNGFBFLINDFP-QHCPKHFHSA-N |
| XLogP | 5.28 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|