C29H28N4O2S — CID 17481393
3-[[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-benzyl-5-phenylimidazolidine-2,4-dione (PubChem CID 17481393) has the molecular formula C29H28N4O2S and a molecular weight of 496.64 g/mol. Its IUPAC name is 3-[[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-benzyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-benzyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17481393 |
| Molecular Formula | C29H28N4O2S |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 3-[[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]methyl]-5-benzyl-5-phenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(Cc2ccccc2)(c2ccccc2)C(=O)N1CN1CCCC(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C29H28N4O2S/c34-27-29(23-13-5-2-6-14-23,18-21-10-3-1-4-11-21)31-28(35)33(27)20-32-17-9-12-22(19-32)26-30-24-15-7-8-16-25(24)36-26/h1-8,10-11,13-16,22H,9,12,17-20H2,(H,31,35) |
| InChIKey | OADBKJMVVFXTEG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|