C19H26ClN5OS — CID 78820098
2-[[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 78820098) has the molecular formula C19H26ClN5OS and a molecular weight of 407.97 g/mol. Its IUPAC name is 2-[[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 78820098 |
| Molecular Formula | C19H26ClN5OS |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-[[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(C)nn(CN2CCN(CCOc3ccc(Cl)cc3)CC2)c1=S |
| InChI | InChI=1S/C19H26ClN5OS/c1-3-8-24-16(2)21-25(19(24)27)15-23-11-9-22(10-12-23)13-14-26-18-6-4-17(20)5-7-18/h3-7H,1,8-15H2,2H3 |
| InChIKey | GCSIXFDCRBDBRK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|