C19H21ClN6OS — CID 9241657
2-[[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-cyclopropylamino]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 9241657) has the molecular formula C19H21ClN6OS and a molecular weight of 416.94 g/mol. Its IUPAC name is 2-[[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-cyclopropylamino]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-cyclopropylamino]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9241657 |
| Molecular Formula | C19H21ClN6OS |
| Molecular Weight | 416.94 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-[[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methyl-cyclopropylamino]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(C)nn(CN(Cc2nnc(-c3ccc(Cl)cc3)o2)C2CC2)c1=S |
| InChI | InChI=1S/C19H21ClN6OS/c1-3-10-25-13(2)23-26(19(25)28)12-24(16-8-9-16)11-17-21-22-18(27-17)14-4-6-15(20)7-5-14/h3-7,16H,1,8-12H2,2H3 |
| InChIKey | HWJLKLNNRQZUQQ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 64.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.94 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|