C22H30ClN5OS — CID 55859937
5-(4-chlorophenyl)-2-[[4-(morpholin-4-ylmethyl)piperidin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 55859937) has the molecular formula C22H30ClN5OS and a molecular weight of 448.04 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[4-(morpholin-4-ylmethyl)piperidin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-chlorophenyl)-2-[[4-(morpholin-4-ylmethyl)piperidin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 55859937 |
| Molecular Formula | C22H30ClN5OS |
| Molecular Weight | 448.04 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[4-(morpholin-4-ylmethyl)piperidin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(-c2ccc(Cl)cc2)nn(CN2CCC(CN3CCOCC3)CC2)c1=S |
| InChI | InChI=1S/C22H30ClN5OS/c1-2-9-27-21(19-3-5-20(23)6-4-19)24-28(22(27)30)17-26-10-7-18(8-11-26)16-25-12-14-29-15-13-25/h2-6,18H,1,7-17H2 |
| InChIKey | HIOCGZHQSNNNHL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.04 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|