C16H22N4OS — CID 78785988
4-ethyl-5-(3-methylphenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 78785988) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 4-ethyl-5-(3-methylphenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 4-ethyl-5-(3-methylphenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 78785988 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 4-ethyl-5-(3-methylphenyl)-2-(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2cccc(C)c2)nn(CN2CCOCC2)c1=S |
| InChI | InChI=1S/C16H22N4OS/c1-3-19-15(14-6-4-5-13(2)11-14)17-20(16(19)22)12-18-7-9-21-10-8-18/h4-6,11H,3,7-10,12H2,1-2H3 |
| InChIKey | FLPWBJKUMVBPOB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|