C23H35N5OS — CID 78904525
1-[[4-ethyl-3-(3-methylphenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 78904525) has the molecular formula C23H35N5OS and a molecular weight of 429.63 g/mol. Its IUPAC name is 1-[[4-ethyl-3-(3-methylphenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[[4-ethyl-3-(3-methylphenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 78904525 |
| Molecular Formula | C23H35N5OS |
| Molecular Weight | 429.63 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 1-[[4-ethyl-3-(3-methylphenyl)-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(Cn2nc(-c3cccc(C)c3)n(CC)c2=S)CC1 |
| InChI | InChI=1S/C23H35N5OS/c1-4-6-7-13-24-22(29)19-11-14-26(15-12-19)17-28-23(30)27(5-2)21(25-28)20-10-8-9-18(3)16-20/h8-10,16,19H,4-7,11-15,17H2,1-3H3,(H,24,29) |
| InChIKey | RYHSJXWUHNDIRU-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|