C23H33N5OS — CID 9320138
azepan-1-yl-[1-[(4-ethyl-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]methanone (PubChem CID 9320138) has the molecular formula C23H33N5OS and a molecular weight of 427.62 g/mol. Its IUPAC name is azepan-1-yl-[1-[(4-ethyl-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[(4-ethyl-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 9320138 |
| Molecular Formula | C23H33N5OS |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | azepan-1-yl-[1-[(4-ethyl-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperidin-4-yl]methanone |
| SMILES | CCn1c(-c2ccccc2)nn(CN2CCC(C(=O)N3CCCCCC3)CC2)c1=S |
| InChI | InChI=1S/C23H33N5OS/c1-2-27-21(19-10-6-5-7-11-19)24-28(23(27)30)18-25-16-12-20(13-17-25)22(29)26-14-8-3-4-9-15-26/h5-7,10-11,20H,2-4,8-9,12-18H2,1H3 |
| InChIKey | WKTBGYNHBLCOHJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 46.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|