C22H27N5S — CID 11463520
2-[(4-benzylpiperazin-1-yl)methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 11463520) has the molecular formula C22H27N5S and a molecular weight of 393.56 g/mol. Its IUPAC name is 2-[(4-benzylpiperazin-1-yl)methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-benzylpiperazin-1-yl)methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 11463520 |
| Molecular Formula | C22H27N5S |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 2-[(4-benzylpiperazin-1-yl)methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccccc2)nn(CN2CCN(Cc3ccccc3)CC2)c1=S |
| InChI | InChI=1S/C22H27N5S/c1-2-26-21(20-11-7-4-8-12-20)23-27(22(26)28)18-25-15-13-24(14-16-25)17-19-9-5-3-6-10-19/h3-12H,2,13-18H2,1H3 |
| InChIKey | YPXDIWSMUMSRIE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 29.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|