C17H24N4OS — CID 29426003
2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 29426003) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is 2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 29426003 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]-4-ethyl-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccccc2)nn(CN2C[C@@H](C)O[C@H](C)C2)c1=S |
| InChI | InChI=1S/C17H24N4OS/c1-4-20-16(15-8-6-5-7-9-15)18-21(17(20)23)12-19-10-13(2)22-14(3)11-19/h5-9,13-14H,4,10-12H2,1-3H3/t13-,14-/m1/s1 |
| InChIKey | LUFHYZSOCNUYNA-ZIAGYGMSSA-N |
| XLogP | 3.17 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|