C17H18N4S — CID 694669
2-(anilinomethyl)-4-ethyl-5-phenyl-1,2,4-triazole-3-thione (PubChem CID 694669) has the molecular formula C17H18N4S and a molecular weight of 310.43 g/mol. Its IUPAC name is 2-(anilinomethyl)-4-ethyl-5-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-(anilinomethyl)-4-ethyl-5-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 694669 |
| Molecular Formula | C17H18N4S |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-(anilinomethyl)-4-ethyl-5-phenyl-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccccc2)nn(CNc2ccccc2)c1=S |
| InChI | InChI=1S/C17H18N4S/c1-2-20-16(14-9-5-3-6-10-14)19-21(17(20)22)13-18-15-11-7-4-8-12-15/h3-12,18H,2,13H2,1H3 |
| InChIKey | PUTKZEUQMUHPQL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|