C20H23BrN4O2S — CID 2106134
4-benzyl-5-(5-bromofuran-2-yl)-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 2106134) has the molecular formula C20H23BrN4O2S and a molecular weight of 463.40 g/mol. Its IUPAC name is 4-benzyl-5-(5-bromofuran-2-yl)-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-benzyl-5-(5-bromofuran-2-yl)-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2106134 |
| Molecular Formula | C20H23BrN4O2S |
| Molecular Weight | 463.40 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 4-benzyl-5-(5-bromofuran-2-yl)-2-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | C[C@@H]1CN(Cn2nc(-c3ccc(Br)o3)n(Cc3ccccc3)c2=S)C[C@H](C)O1 |
| InChI | InChI=1S/C20H23BrN4O2S/c1-14-10-23(11-15(2)26-14)13-25-20(28)24(12-16-6-4-3-5-7-16)19(22-25)17-8-9-18(21)27-17/h3-9,14-15H,10-13H2,1-2H3/t14-,15+ |
| InChIKey | ONCOGRPIPFREAS-GASCZTMLSA-N |
| XLogP | 4.55 |
| TPSA | 48.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|